C20H28O3 — CID 144528423
[(2R,4E,7R)-9-ethoxy-7-methyldeca-4,9-dien-2-yl] benzoate (PubChem CID 144528423) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(2R,4E,7R)-9-ethoxy-7-methyldeca-4,9-dien-2-yl] benzoate.
| Compound Name | [(2R,4E,7R)-9-ethoxy-7-methyldeca-4,9-dien-2-yl] benzoate |
|---|---|
| PubChem CID | 144528423 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [(2R,4E,7R)-9-ethoxy-7-methyldeca-4,9-dien-2-yl] benzoate |
| SMILES | C=C(C[C@H](C)C/C=C/C[C@@H](C)OC(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C20H28O3/c1-5-22-18(4)15-16(2)11-9-10-12-17(3)23-20(21)19-13-7-6-8-14-19/h6-10,13-14,16-17H,4-5,11-12,15H2,1-3H3/b10-9+/t16-,17-/m1/s1 |
| InChIKey | QKZWCVJJFBXSMZ-VEUZHWNKSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|