C18H23NO5 — CID 144528687
[2-methoxy-4-[(2-oxooxolan-3-yl)methyl]phenyl] piperidine-1-carboxylate (PubChem CID 144528687) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [2-methoxy-4-[(2-oxooxolan-3-yl)methyl]phenyl] piperidine-1-carboxylate.
| Compound Name | [2-methoxy-4-[(2-oxooxolan-3-yl)methyl]phenyl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144528687 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [2-methoxy-4-[(2-oxooxolan-3-yl)methyl]phenyl] piperidine-1-carboxylate |
| SMILES | COc1cc(CC2CCOC2=O)ccc1OC(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H23NO5/c1-22-16-12-13(11-14-7-10-23-17(14)20)5-6-15(16)24-18(21)19-8-3-2-4-9-19/h5-6,12,14H,2-4,7-11H2,1H3 |
| InChIKey | UHSRDILHUFLRLL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |