C10H17F2NO3 — CID 144528998
(3aR,4S,6aS)-4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-amine (PubChem CID 144528998) has the molecular formula C10H17F2NO3 and a molecular weight of 237.25 g/mol. Its IUPAC name is (3aR,4S,6aS)-4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-amine.
| Compound Name | (3aR,4S,6aS)-4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-amine |
|---|---|
| PubChem CID | 144528998 |
| Molecular Formula | C10H17F2NO3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3aR,4S,6aS)-4-(2,2-difluoroethoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](OCC(F)F)CC(N)[C@@H]2O1 |
| InChI | InChI=1S/C10H17F2NO3/c1-10(2)15-8-5(13)3-6(9(8)16-10)14-4-7(11)12/h5-9H,3-4,13H2,1-2H3/t5?,6-,8-,9+/m0/s1 |
| InChIKey | OSEUINMTVQKCDT-XRIIEEERSA-N |
| XLogP | 0.89 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |