C10H17BO4 — CID 123923765
CID 123923765 (PubChem CID 123923765) has the molecular formula C10H17BO4 and a molecular weight of 212.05 g/mol.
| Compound Name | CID 123923765 |
|---|---|
| PubChem CID | 123923765 |
| Molecular Formula | C10H17BO4 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | — |
| SMILES | [B]C1CC(OCCO)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C10H17BO4/c1-10(2)14-8-6(11)5-7(9(8)15-10)13-4-3-12/h6-9,12H,3-5H2,1-2H3 |
| InChIKey | JCBTTWNFTIWEQB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|