C22H32O4 — CID 144530832
[(E)-3-(2-tert-butyl-2,4-dimethylpentanoyl)oxyprop-2-enyl] 4-methylbenzoate (PubChem CID 144530832) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(E)-3-(2-tert-butyl-2,4-dimethylpentanoyl)oxyprop-2-enyl] 4-methylbenzoate.
| Compound Name | [(E)-3-(2-tert-butyl-2,4-dimethylpentanoyl)oxyprop-2-enyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 144530832 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(E)-3-(2-tert-butyl-2,4-dimethylpentanoyl)oxyprop-2-enyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC/C=C/OC(=O)C(C)(CC(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H32O4/c1-16(2)15-22(7,21(4,5)6)20(24)26-14-8-13-25-19(23)18-11-9-17(3)10-12-18/h8-12,14,16H,13,15H2,1-7H3/b14-8+ |
| InChIKey | STGOMUHHJCLRRP-RIYZIHGNSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|