C22H28N4O — CID 144531808
13-[(4R)-1-benzyl-4-methylpiperidin-3-yl]-11-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,7-triene (PubChem CID 144531808) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 13-[(4R)-1-benzyl-4-methylpiperidin-3-yl]-11-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,7-triene.
| Compound Name | 13-[(4R)-1-benzyl-4-methylpiperidin-3-yl]-11-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,7-triene |
|---|---|
| PubChem CID | 144531808 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 13-[(4R)-1-benzyl-4-methylpiperidin-3-yl]-11-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,7-triene |
| SMILES | C[C@@H]1CCN(Cc2ccccc2)CC1N1COCC2=C1C1C=CNC1N=C2 |
| InChI | InChI=1S/C22H28N4O/c1-16-8-10-25(12-17-5-3-2-4-6-17)13-20(16)26-15-27-14-18-11-24-22-19(21(18)26)7-9-23-22/h2-7,9,11,16,19-20,22-23H,8,10,12-15H2,1H3/t16-,19?,20?,22?/m1/s1 |
| InChIKey | TUFFHIVHJMQTHA-UDNPVYIMSA-N |
| XLogP | 2.58 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |