C25H20N2O5S2 — CID 144533755
1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithiatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 144533755) has the molecular formula C25H20N2O5S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithiatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | 1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithiatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 144533755 |
| Molecular Formula | C25H20N2O5S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithiatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(C#Cc2cc3c(s2)OS2=C(O)C4(CC4)C2=C3)c1NC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O5S2/c1-14-21(26-24(29)30-15(2)16-6-4-3-5-7-16)19(31-27-14)9-8-18-12-17-13-20-25(10-11-25)23(28)34(20)32-22(17)33-18/h3-7,12-13,15,28H,10-11H2,1-2H3,(H,26,29) |
| InChIKey | IJJKUEJRZJIRGK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|