C22H18N6O4S2 — CID 144533324
1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithia-7,9-diazatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyltriazol-4-yl]carbamate (PubChem CID 144533324) has the molecular formula C22H18N6O4S2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithia-7,9-diazatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyltriazol-4-yl]carbamate.
| Compound Name | 1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithia-7,9-diazatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 144533324 |
| Molecular Formula | C22H18N6O4S2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 1-phenylethyl N-[5-[2-(4-hydroxyspiro[2-oxa-3λ4,11-dithia-7,9-diazatricyclo[6.3.0.03,6]undeca-1(8),3,6,9-tetraene-5,1'-cyclopropane]-10-yl)ethynyl]-3-methyltriazol-4-yl]carbamate |
| SMILES | CC(OC(=O)Nc1c(C#Cc2nc3c(s2)OS2=C(O)C4(CC4)C2=N3)nnn1C)c1ccccc1 |
| InChI | InChI=1S/C22H18N6O4S2/c1-12(13-6-4-3-5-7-13)31-21(30)25-17-14(26-27-28(17)2)8-9-15-23-16-18(33-15)32-34-19(24-16)22(10-11-22)20(34)29/h3-7,12,29H,10-11H2,1-2H3,(H,25,30) |
| InChIKey | XOWJCJHZUACOFX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|