C18H17ClN4O2 — CID 70819210
[(1R)-1-phenylethyl] N-[5-(4-chlorophenyl)-3-methyltriazol-4-yl]carbamate (PubChem CID 70819210) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-[5-(4-chlorophenyl)-3-methyltriazol-4-yl]carbamate.
| Compound Name | [(1R)-1-phenylethyl] N-[5-(4-chlorophenyl)-3-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 70819210 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [(1R)-1-phenylethyl] N-[5-(4-chlorophenyl)-3-methyltriazol-4-yl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1c(-c2ccc(Cl)cc2)nnn1C)c1ccccc1 |
| InChI | InChI=1S/C18H17ClN4O2/c1-12(13-6-4-3-5-7-13)25-18(24)20-17-16(21-22-23(17)2)14-8-10-15(19)11-9-14/h3-12H,1-2H3,(H,20,24)/t12-/m1/s1 |
| InChIKey | KHKORLAHFICSED-GFCCVEGCSA-N |
| XLogP | 4.45 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |