C18H19ClN6O4S — CID 168835619
[(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[4-(methanesulfonamido)phenyl]-3-methyltriazol-4-yl]carbamate (PubChem CID 168835619) has the molecular formula C18H19ClN6O4S and a molecular weight of 450.91 g/mol. Its IUPAC name is [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[4-(methanesulfonamido)phenyl]-3-methyltriazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[4-(methanesulfonamido)phenyl]-3-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 168835619 |
| Molecular Formula | C18H19ClN6O4S |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[4-(methanesulfonamido)phenyl]-3-methyltriazol-4-yl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1c(-c2ccc(NS(C)(=O)=O)cc2)nnn1C)c1cccnc1Cl |
| InChI | InChI=1S/C18H19ClN6O4S/c1-11(14-5-4-10-20-16(14)19)29-18(26)21-17-15(22-24-25(17)2)12-6-8-13(9-7-12)23-30(3,27)28/h4-11,23H,1-3H3,(H,21,26)/t11-/m1/s1 |
| InChIKey | HMDBQEDXLZITIG-LLVKDONJSA-N |
| XLogP | 3.21 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|