C24H28ClN7O6S — CID 170029324
2-[1-[[6-[5-[[(1R)-1-(2-chloro-3-pyridinyl)ethoxy]carbonylamino]-1-methyltriazol-4-yl]-3-pyridinyl]carbamoyl]cyclobutyl]ethyl methanesulfonate (PubChem CID 170029324) has the molecular formula C24H28ClN7O6S and a molecular weight of 578.05 g/mol. Its IUPAC name is 2-[1-[[6-[5-[[(1R)-1-(2-chloro-3-pyridinyl)ethoxy]carbonylamino]-1-methyltriazol-4-yl]-3-pyridinyl]carbamoyl]cyclobutyl]ethyl methanesulfonate.
| Compound Name | 2-[1-[[6-[5-[[(1R)-1-(2-chloro-3-pyridinyl)ethoxy]carbonylamino]-1-methyltriazol-4-yl]-3-pyridinyl]carbamoyl]cyclobutyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 170029324 |
| Molecular Formula | C24H28ClN7O6S |
| Molecular Weight | 578.05 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 2-[1-[[6-[5-[[(1R)-1-(2-chloro-3-pyridinyl)ethoxy]carbonylamino]-1-methyltriazol-4-yl]-3-pyridinyl]carbamoyl]cyclobutyl]ethyl methanesulfonate |
| SMILES | C[C@@H](OC(=O)Nc1c(-c2ccc(NC(=O)C3(CCOS(C)(=O)=O)CCC3)cn2)nnn1C)c1cccnc1Cl |
| InChI | InChI=1S/C24H28ClN7O6S/c1-15(17-6-4-12-26-20(17)25)38-23(34)29-21-19(30-31-32(21)2)18-8-7-16(14-27-18)28-22(33)24(9-5-10-24)11-13-37-39(3,35)36/h4,6-8,12,14-15H,5,9-11,13H2,1-3H3,(H,28,33)(H,29,34)/t15-/m1/s1 |
| InChIKey | LPMDVGVJXGZCOV-OAHLLOKOSA-N |
| XLogP | 3.71 |
| TPSA | 167.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.05 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|