C32H34F2N2O3S — CID 144533938
[(1R)-1-phenylethyl] N-[5-[2,6-difluoro-4-[4-(5-methoxyhexyl)phenyl]phenyl]-3-methyl-1,2-thiazol-4-yl]carbamate (PubChem CID 144533938) has the molecular formula C32H34F2N2O3S and a molecular weight of 564.70 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-[5-[2,6-difluoro-4-[4-(5-methoxyhexyl)phenyl]phenyl]-3-methyl-1,2-thiazol-4-yl]carbamate.
| Compound Name | [(1R)-1-phenylethyl] N-[5-[2,6-difluoro-4-[4-(5-methoxyhexyl)phenyl]phenyl]-3-methyl-1,2-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 144533938 |
| Molecular Formula | C32H34F2N2O3S |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | [(1R)-1-phenylethyl] N-[5-[2,6-difluoro-4-[4-(5-methoxyhexyl)phenyl]phenyl]-3-methyl-1,2-thiazol-4-yl]carbamate |
| SMILES | COC(C)CCCCc1ccc(-c2cc(F)c(-c3snc(C)c3NC(=O)O[C@H](C)c3ccccc3)c(F)c2)cc1 |
| InChI | InChI=1S/C32H34F2N2O3S/c1-20(38-4)10-8-9-11-23-14-16-25(17-15-23)26-18-27(33)29(28(34)19-26)31-30(21(2)36-40-31)35-32(37)39-22(3)24-12-6-5-7-13-24/h5-7,12-20,22H,8-11H2,1-4H3,(H,35,37)/t20?,22-/m1/s1 |
| InChIKey | FITSZXHRNVBPOA-LWMIZPGFSA-N |
| XLogP | 9.12 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|