C31H31N2NaO6 — CID 144534093
sodium;benzyl formate;4-[4-[4-[3-methyl-4-(methylamino)-1,2-oxazol-5-yl]phenyl]phenyl]oxane-4-carboxylate (PubChem CID 144534093) has the molecular formula C31H31N2NaO6 and a molecular weight of 550.59 g/mol. Its IUPAC name is sodium;benzyl formate;4-[4-[4-[3-methyl-4-(methylamino)-1,2-oxazol-5-yl]phenyl]phenyl]oxane-4-carboxylate.
| Compound Name | sodium;benzyl formate;4-[4-[4-[3-methyl-4-(methylamino)-1,2-oxazol-5-yl]phenyl]phenyl]oxane-4-carboxylate |
|---|---|
| PubChem CID | 144534093 |
| Molecular Formula | C31H31N2NaO6 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | sodium;benzyl formate;4-[4-[4-[3-methyl-4-(methylamino)-1,2-oxazol-5-yl]phenyl]phenyl]oxane-4-carboxylate |
| SMILES | CNc1c(C)noc1-c1ccc(-c2ccc(C3(C(=O)[O-])CCOCC3)cc2)cc1.O=COCc1ccccc1.[Na+] |
| InChI | InChI=1S/C23H24N2O4.C8H8O2.Na/c1-15-20(24-2)21(29-25-15)18-5-3-16(4-6-18)17-7-9-19(10-8-17)23(22(26)27)11-13-28-14-12-23;9-7-10-6-8-4-2-1-3-5-8;/h3-10,24H,11-14H2,1-2H3,(H,26,27);1-5,7H,6H2;/q;;+1/p-1 |
| InChIKey | YUXSNDVJDWMQIN-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|