C24H29BN2O4S — CID 144534720
ethane;6-[[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile (PubChem CID 144534720) has the molecular formula C24H29BN2O4S and a molecular weight of 452.39 g/mol. Its IUPAC name is ethane;6-[[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile.
| Compound Name | ethane;6-[[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile |
|---|---|
| PubChem CID | 144534720 |
| Molecular Formula | C24H29BN2O4S |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | ethane;6-[[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile |
| SMILES | CC.COc1cc(COc2ccc3nc(C#N)sc3c2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H23BN2O4S.C2H6/c1-21(2)22(3,4)29-23(28-21)16-8-6-14(10-18(16)26-5)13-27-15-7-9-17-19(11-15)30-20(12-24)25-17;1-2/h6-11H,13H2,1-5H3;1-2H3 |
| InChIKey | KXMGZZOCPBDHAS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|