C21H20BFN2O3S — CID 71256685
6-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile (PubChem CID 71256685) has the molecular formula C21H20BFN2O3S and a molecular weight of 410.28 g/mol. Its IUPAC name is 6-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile.
| Compound Name | 6-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile |
|---|---|
| PubChem CID | 71256685 |
| Molecular Formula | C21H20BFN2O3S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 6-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-1,3-benzothiazole-2-carbonitrile |
| SMILES | CC1(C)OB(c2ccc(COc3ccc4nc(C#N)sc4c3)cc2F)OC1(C)C |
| InChI | InChI=1S/C21H20BFN2O3S/c1-20(2)21(3,4)28-22(27-20)15-7-5-13(9-16(15)23)12-26-14-6-8-17-18(10-14)29-19(11-24)25-17/h5-10H,12H2,1-4H3 |
| InChIKey | DSWRTOVQDVWEDT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|