C22H28BFO3 — CID 113249691
2-[2-fluoro-5-[(4-propylphenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 113249691) has the molecular formula C22H28BFO3 and a molecular weight of 370.27 g/mol. Its IUPAC name is 2-[2-fluoro-5-[(4-propylphenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-fluoro-5-[(4-propylphenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 113249691 |
| Molecular Formula | C22H28BFO3 |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[2-fluoro-5-[(4-propylphenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCc1ccc(OCc2ccc(F)c(B3OC(C)(C)C(C)(C)O3)c2)cc1 |
| InChI | InChI=1S/C22H28BFO3/c1-6-7-16-8-11-18(12-9-16)25-15-17-10-13-20(24)19(14-17)23-26-21(2,3)22(4,5)27-23/h8-14H,6-7,15H2,1-5H3 |
| InChIKey | DJCGSECJRBZFJI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|