C19H22N5O+ — CID 144534986
15,15-dimethyl-N-pyrrolidin-3-yl-8,11-diaza-12-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10,13-hexaene-4-carboxamide (PubChem CID 144534986) has the molecular formula C19H22N5O+ and a molecular weight of 336.42 g/mol. Its IUPAC name is 15,15-dimethyl-N-pyrrolidin-3-yl-8,11-diaza-12-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10,13-hexaene-4-carboxamide.
| Compound Name | 15,15-dimethyl-N-pyrrolidin-3-yl-8,11-diaza-12-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10,13-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 144534986 |
| Molecular Formula | C19H22N5O+ |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 15,15-dimethyl-N-pyrrolidin-3-yl-8,11-diaza-12-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10,13-hexaene-4-carboxamide |
| SMILES | CC1(C)C2=C[NH2+]N=C2c2[nH]c3ccc(C(=O)NC4CCNC4)cc3c21 |
| InChI | InChI=1S/C19H21N5O/c1-19(2)13-9-21-24-16(13)17-15(19)12-7-10(3-4-14(12)23-17)18(25)22-11-5-6-20-8-11/h3-4,7,9,11,20,23H,5-6,8H2,1-2H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | SZEUANQNASOVKX-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|