C27H37N7O4 — CID 144535052
N-[1-(3-amino-1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-7-(methoxymethyl)-5,5,7-trimethyl-8-oxo-6,9-dihydrocarbazole-3-carboxamide;ethane (PubChem CID 144535052) has the molecular formula C27H37N7O4 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[1-(3-amino-1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-7-(methoxymethyl)-5,5,7-trimethyl-8-oxo-6,9-dihydrocarbazole-3-carboxamide;ethane.
| Compound Name | N-[1-(3-amino-1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-7-(methoxymethyl)-5,5,7-trimethyl-8-oxo-6,9-dihydrocarbazole-3-carboxamide;ethane |
|---|---|
| PubChem CID | 144535052 |
| Molecular Formula | C27H37N7O4 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | N-[1-(3-amino-1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-7-(methoxymethyl)-5,5,7-trimethyl-8-oxo-6,9-dihydrocarbazole-3-carboxamide;ethane |
| SMILES | CC.COCC1(C)CC(C)(C)c2c([nH]c3ccc(C(=O)NC4CCN(C(=O)c5nc(N)n[nH]5)C4)cc23)C1=O |
| InChI | InChI=1S/C25H31N7O4.C2H6/c1-24(2)11-25(3,12-36-4)19(33)18-17(24)15-9-13(5-6-16(15)28-18)21(34)27-14-7-8-32(10-14)22(35)20-29-23(26)31-30-20;1-2/h5-6,9,14,28H,7-8,10-12H2,1-4H3,(H,27,34)(H3,26,29,30,31);1-2H3 |
| InChIKey | ILSWEBLAEGGGGX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 159.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |