C17H12O3 — CID 144536786
1,4-dioxo-2-[(2Z)-penta-2,4-dienyl]benzo[7]annulene-3-carbaldehyde (PubChem CID 144536786) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1,4-dioxo-2-[(2Z)-penta-2,4-dienyl]benzo[7]annulene-3-carbaldehyde.
| Compound Name | 1,4-dioxo-2-[(2Z)-penta-2,4-dienyl]benzo[7]annulene-3-carbaldehyde |
|---|---|
| PubChem CID | 144536786 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1,4-dioxo-2-[(2Z)-penta-2,4-dienyl]benzo[7]annulene-3-carbaldehyde |
| SMILES | C=C/C=C\CC1=C(C=O)C(=O)C2=C=CC=CC=C2C1=O |
| InChI | InChI=1S/C17H12O3/c1-2-3-5-8-14-15(11-18)17(20)13-10-7-4-6-9-12(13)16(14)19/h2-7,9,11H,1,8H2/b5-3- |
| InChIKey | KMQIIAAZUSYSRI-HYXAFXHYSA-N |
| XLogP | 2.34 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|