C19H10O5 — CID 134942087
4,5,10-trimethylidene-1,8,9-trioxoanthracene-2,7-dicarbaldehyde (PubChem CID 134942087) has the molecular formula C19H10O5 and a molecular weight of 318.28 g/mol. Its IUPAC name is 4,5,10-trimethylidene-1,8,9-trioxoanthracene-2,7-dicarbaldehyde.
| Compound Name | 4,5,10-trimethylidene-1,8,9-trioxoanthracene-2,7-dicarbaldehyde |
|---|---|
| PubChem CID | 134942087 |
| Molecular Formula | C19H10O5 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4,5,10-trimethylidene-1,8,9-trioxoanthracene-2,7-dicarbaldehyde |
| SMILES | C=C1C=C(C=O)C(=O)C2=C1C(=C)C1=C(C(=O)C(C=O)=CC1=C)C2=O |
| InChI | InChI=1S/C19H10O5/c1-8-4-11(6-20)17(22)15-13(8)10(3)14-9(2)5-12(7-21)18(23)16(14)19(15)24/h4-7H,1-3H2 |
| InChIKey | OKJYBPSXRVQVNO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|