C17H18O4 — CID 163790156
(3Z)-5-(2-formylprop-2-enoyl)-4-methyl-3-(3-methylbutan-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carbaldehyde (PubChem CID 163790156) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (3Z)-5-(2-formylprop-2-enoyl)-4-methyl-3-(3-methylbutan-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carbaldehyde.
| Compound Name | (3Z)-5-(2-formylprop-2-enoyl)-4-methyl-3-(3-methylbutan-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163790156 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (3Z)-5-(2-formylprop-2-enoyl)-4-methyl-3-(3-methylbutan-2-ylidene)-6-oxocyclohexa-1,4-diene-1-carbaldehyde |
| SMILES | C=C(C=O)C(=O)C1=C(C)/C(=C(/C)C(C)C)C=C(C=O)C1=O |
| InChI | InChI=1S/C17H18O4/c1-9(2)11(4)14-6-13(8-19)17(21)15(12(14)5)16(20)10(3)7-18/h6-9H,3H2,1-2,4-5H3/b14-11- |
| InChIKey | MVZAPPMIDZWTJG-KAMYIIQDSA-N |
| XLogP | 2.31 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|