C18H20S — CID 144536878
2-(4-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)thiophene (PubChem CID 144536878) has the molecular formula C18H20S and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-(4-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)thiophene.
| Compound Name | 2-(4-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)thiophene |
|---|---|
| PubChem CID | 144536878 |
| Molecular Formula | C18H20S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-(4-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)thiophene |
| SMILES | Cc1ccc(-c2ccc(C3C=CC(C)CC3)s2)cc1 |
| InChI | InChI=1S/C18H20S/c1-13-3-7-15(8-4-13)17-11-12-18(19-17)16-9-5-14(2)6-10-16/h3-5,7-9,11-12,14,16H,6,10H2,1-2H3 |
| InChIKey | FFPRFFYKBGKCCZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|