C23H18FN6O2P — CID 144537128
3-[2-(2-fluorophenyl)pyrazol-3-yl]-5-methoxy-1-(2-phosphanyl-4-pyrazol-1-ylphenyl)pyridazin-4-one (PubChem CID 144537128) has the molecular formula C23H18FN6O2P and a molecular weight of 460.41 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)pyrazol-3-yl]-5-methoxy-1-(2-phosphanyl-4-pyrazol-1-ylphenyl)pyridazin-4-one.
| Compound Name | 3-[2-(2-fluorophenyl)pyrazol-3-yl]-5-methoxy-1-(2-phosphanyl-4-pyrazol-1-ylphenyl)pyridazin-4-one |
|---|---|
| PubChem CID | 144537128 |
| Molecular Formula | C23H18FN6O2P |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-[2-(2-fluorophenyl)pyrazol-3-yl]-5-methoxy-1-(2-phosphanyl-4-pyrazol-1-ylphenyl)pyridazin-4-one |
| SMILES | COc1cn(-c2ccc(-n3cccn3)cc2P)nc(-c2ccnn2-c2ccccc2F)c1=O |
| InChI | InChI=1S/C23H18FN6O2P/c1-32-20-14-29(18-8-7-15(13-21(18)33)28-12-4-10-25-28)27-22(23(20)31)19-9-11-26-30(19)17-6-3-2-5-16(17)24/h2-14H,33H2,1H3 |
| InChIKey | DTABMKPMIDFJKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|