C23H20F2N4O3 — CID 129234805
1-[2-(difluoromethoxy)-4-ethylphenyl]-5-methoxy-3-(2-phenylpyrazol-3-yl)pyridazin-4-one (PubChem CID 129234805) has the molecular formula C23H20F2N4O3 and a molecular weight of 438.43 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-ethylphenyl]-5-methoxy-3-(2-phenylpyrazol-3-yl)pyridazin-4-one.
| Compound Name | 1-[2-(difluoromethoxy)-4-ethylphenyl]-5-methoxy-3-(2-phenylpyrazol-3-yl)pyridazin-4-one |
|---|---|
| PubChem CID | 129234805 |
| Molecular Formula | C23H20F2N4O3 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-ethylphenyl]-5-methoxy-3-(2-phenylpyrazol-3-yl)pyridazin-4-one |
| SMILES | CCc1ccc(-n2cc(OC)c(=O)c(-c3ccnn3-c3ccccc3)n2)c(OC(F)F)c1 |
| InChI | InChI=1S/C23H20F2N4O3/c1-3-15-9-10-17(19(13-15)32-23(24)25)28-14-20(31-2)22(30)21(27-28)18-11-12-26-29(18)16-7-5-4-6-8-16/h4-14,23H,3H2,1-2H3 |
| InChIKey | ZZJIEYZDDJAUKS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |