C22H17FN3O5S- — CID 91332748
[3-fluoro-4-[5-methoxy-2-methyl-4-oxo-3-(2-phenylpyrazol-3-yl)-1-pyridinyl]phenyl] sulfite (PubChem CID 91332748) has the molecular formula C22H17FN3O5S- and a molecular weight of 454.46 g/mol. Its IUPAC name is [3-fluoro-4-[5-methoxy-2-methyl-4-oxo-3-(2-phenylpyrazol-3-yl)-1-pyridinyl]phenyl] sulfite.
| Compound Name | [3-fluoro-4-[5-methoxy-2-methyl-4-oxo-3-(2-phenylpyrazol-3-yl)-1-pyridinyl]phenyl] sulfite |
|---|---|
| PubChem CID | 91332748 |
| Molecular Formula | C22H17FN3O5S- |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | [3-fluoro-4-[5-methoxy-2-methyl-4-oxo-3-(2-phenylpyrazol-3-yl)-1-pyridinyl]phenyl] sulfite |
| SMILES | COc1cn(-c2ccc(OS(=O)[O-])cc2F)c(C)c(-c2ccnn2-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H18FN3O5S/c1-14-21(19-10-11-24-26(19)15-6-4-3-5-7-15)22(27)20(30-2)13-25(14)18-9-8-16(12-17(18)23)31-32(28)29/h3-13H,1-2H3,(H,28,29)/p-1 |
| InChIKey | AVYSESJHECTIBI-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 98.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|