C10H10O6 — CID 144538170
methyl 5-formyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4-carboxylate (PubChem CID 144538170) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is methyl 5-formyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4-carboxylate.
| Compound Name | methyl 5-formyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4-carboxylate |
|---|---|
| PubChem CID | 144538170 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | methyl 5-formyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4-carboxylate |
| SMILES | COC(=O)C1C(C=O)CC2C(=O)OC(=O)C21 |
| InChI | InChI=1S/C10H10O6/c1-15-9(13)6-4(3-11)2-5-7(6)10(14)16-8(5)12/h3-7H,2H2,1H3 |
| InChIKey | ABAZVGQPOLSCHP-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|