About (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine
(1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine (PubChem CID 144538386) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine |
| PubChem CID | 144538386 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine |
| SMILES | CC(/C=C\CC1CC1)=C/N |
| InChI | InChI=1S/C9H15N/c1-8(7-10)3-2-4-9-5-6-9/h2-3,7,9H,4-6,10H2,1H3/b3-2-,8-7- |
| InChIKey | VQKXSOXYPWZTSD-BLEQRIPJSA-N |
| XLogP | 2.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine?
The IUPAC name of (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine (CID 144538386) is (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine.
What is the SMILES notation for (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine?
The canonical SMILES for (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine is CC(/C=C\CC1CC1)=C/N.
What is the InChIKey of (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine?
The InChIKey is VQKXSOXYPWZTSD-BLEQRIPJSA-N. The full InChI is InChI=1S/C9H15N/c1-8(7-10)3-2-4-9-5-6-9/h2-3,7,9H,4-6,10H2,1H3/b3-2-,8-7-.
What are the key properties of (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine?
(1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine has a molecular weight of 137.23 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-5-cyclopropyl-2-methylpenta-1,3-dien-1-amine is sourced from PubChem (CID 144538386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).