C14H15ClFNOS — CID 144538904
4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide;ethane (PubChem CID 144538904) has the molecular formula C14H15ClFNOS and a molecular weight of 299.80 g/mol. Its IUPAC name is 4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide;ethane.
| Compound Name | 4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144538904 |
| Molecular Formula | C14H15ClFNOS |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide;ethane |
| SMILES | CC.O=C(NCc1cccc(F)c1)c1cc(Cl)cs1 |
| InChI | InChI=1S/C12H9ClFNOS.C2H6/c13-9-5-11(17-7-9)12(16)15-6-8-2-1-3-10(14)4-8;1-2/h1-5,7H,6H2,(H,15,16);1-2H3 |
| InChIKey | CQPIYLMIXFRYLK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |