C12H9ClFNOS — CID 144538905
4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide (PubChem CID 144538905) has the molecular formula C12H9ClFNOS and a molecular weight of 269.73 g/mol. Its IUPAC name is 4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 144538905 |
| Molecular Formula | C12H9ClFNOS |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 4-chloro-N-[(3-fluorophenyl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)c1cc(Cl)cs1 |
| InChI | InChI=1S/C12H9ClFNOS/c13-9-5-11(17-7-9)12(16)15-6-8-2-1-3-10(14)4-8/h1-5,7H,6H2,(H,15,16) |
| InChIKey | LJPZOZFGQJTHMI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |