C13H18N2O — CID 144542667
(3Z)-5-N-(4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-triene-2,5-diamine (PubChem CID 144542667) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (3Z)-5-N-(4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z)-5-N-(4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 144542667 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (3Z)-5-N-(4-methoxycyclohexa-1,3-dien-1-yl)hexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C(N)/C=C\C(=C)NC1=CC=C(OC)CC1 |
| InChI | InChI=1S/C13H18N2O/c1-10(14)4-5-11(2)15-12-6-8-13(16-3)9-7-12/h4-6,8,15H,1-2,7,9,14H2,3H3/b5-4- |
| InChIKey | JVBTZRUKVFXVON-PLNGDYQASA-N |
| XLogP | 2.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|