C7H11F3N2O — CID 144543061
(5R)-5-ethyl-1-(2,2,2-trifluoroethyl)imidazolidin-2-one (PubChem CID 144543061) has the molecular formula C7H11F3N2O and a molecular weight of 196.17 g/mol. Its IUPAC name is (5R)-5-ethyl-1-(2,2,2-trifluoroethyl)imidazolidin-2-one.
| Compound Name | (5R)-5-ethyl-1-(2,2,2-trifluoroethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 144543061 |
| Molecular Formula | C7H11F3N2O |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (5R)-5-ethyl-1-(2,2,2-trifluoroethyl)imidazolidin-2-one |
| SMILES | CC[C@@H]1CNC(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O/c1-2-5-3-11-6(13)12(5)4-7(8,9)10/h5H,2-4H2,1H3,(H,11,13)/t5-/m1/s1 |
| InChIKey | WWCXFHBFYJBXAJ-RXMQYKEDSA-N |
| XLogP | 1.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |