C20H16N2O2 — CID 144543680
3-ethyl-8-(1,2-oxazol-4-yl)-2-phenylisoquinolin-1-one (PubChem CID 144543680) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-ethyl-8-(1,2-oxazol-4-yl)-2-phenylisoquinolin-1-one.
| Compound Name | 3-ethyl-8-(1,2-oxazol-4-yl)-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144543680 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-ethyl-8-(1,2-oxazol-4-yl)-2-phenylisoquinolin-1-one |
| SMILES | CCc1cc2cccc(-c3cnoc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C20H16N2O2/c1-2-16-11-14-7-6-10-18(15-12-21-24-13-15)19(14)20(23)22(16)17-8-4-3-5-9-17/h3-13H,2H2,1H3 |
| InChIKey | CZDCSHASKGREDC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |