C22H20N2O2 — CID 144544385
1-N-methyl-1-N,4-N-diphenylcyclohepta-2,4,7-triene-1,4-dicarboxamide (PubChem CID 144544385) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-N-methyl-1-N,4-N-diphenylcyclohepta-2,4,7-triene-1,4-dicarboxamide.
| Compound Name | 1-N-methyl-1-N,4-N-diphenylcyclohepta-2,4,7-triene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 144544385 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-N-methyl-1-N,4-N-diphenylcyclohepta-2,4,7-triene-1,4-dicarboxamide |
| SMILES | CN(C(=O)C1=CCC=C(C(=O)Nc2ccccc2)C=C1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O2/c1-24(20-13-6-3-7-14-20)22(26)18-10-8-9-17(15-16-18)21(25)23-19-11-4-2-5-12-19/h2-7,9-16H,8H2,1H3,(H,23,25) |
| InChIKey | CUOKUCMMIFBNDH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |