C15H21N3O2 — CID 144545200
4-[3-(3-amino-4-methylphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one;ethane (PubChem CID 144545200) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[3-(3-amino-4-methylphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one;ethane.
| Compound Name | 4-[3-(3-amino-4-methylphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one;ethane |
|---|---|
| PubChem CID | 144545200 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-[3-(3-amino-4-methylphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one;ethane |
| SMILES | CC.CC(=O)CCc1nc(-c2ccc(C)c(N)c2)no1 |
| InChI | InChI=1S/C13H15N3O2.C2H6/c1-8-3-5-10(7-11(8)14)13-15-12(18-16-13)6-4-9(2)17;1-2/h3,5,7H,4,6,14H2,1-2H3;1-2H3 |
| InChIKey | XLJNFCKKUOLVPI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|