C14H18F3N3O2 — CID 144545214
ethane;2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 144545214) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is ethane;2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | ethane;2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 144545214 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethane;2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | CC.Cc1ccc(-c2noc(COCC(F)(F)F)n2)cc1N |
| InChI | InChI=1S/C12H12F3N3O2.C2H6/c1-7-2-3-8(4-9(7)16)11-17-10(20-18-11)5-19-6-12(13,14)15;1-2/h2-4H,5-6,16H2,1H3;1-2H3 |
| InChIKey | RNTRBNNZAPFMOD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|