C22H23F3N6O3 — CID 177307371
1-ethyl-7-(methylamino)-3-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-4H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 177307371) has the molecular formula C22H23F3N6O3 and a molecular weight of 476.46 g/mol. Its IUPAC name is 1-ethyl-7-(methylamino)-3-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-4H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 1-ethyl-7-(methylamino)-3-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-4H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 177307371 |
| Molecular Formula | C22H23F3N6O3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-ethyl-7-(methylamino)-3-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-4H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | CCN1C(=O)N(c2cc(-c3noc(COCC(F)(F)F)n3)ccc2C)Cc2cnc(NC)cc21 |
| InChI | InChI=1S/C22H23F3N6O3/c1-4-30-17-8-18(26-3)27-9-15(17)10-31(21(30)32)16-7-14(6-5-13(16)2)20-28-19(34-29-20)11-33-12-22(23,24)25/h5-9H,4,10-12H2,1-3H3,(H,26,27) |
| InChIKey | NUWAZEPBNGUWJJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |