C21H18F3N5O6 — CID 144545153
N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-7-(trihydroxymethyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 144545153) has the molecular formula C21H18F3N5O6 and a molecular weight of 493.40 g/mol. Its IUPAC name is N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-7-(trihydroxymethyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-7-(trihydroxymethyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144545153 |
| Molecular Formula | C21H18F3N5O6 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[2-methyl-5-[5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]-7-(trihydroxymethyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2noc(COCC(F)(F)F)n2)cc1NC(=O)c1cnc2cc(C(O)(O)O)ccn12 |
| InChI | InChI=1S/C21H18F3N5O6/c1-11-2-3-12(18-27-17(35-28-18)9-34-10-20(22,23)24)6-14(11)26-19(30)15-8-25-16-7-13(21(31,32)33)4-5-29(15)16/h2-8,31-33H,9-10H2,1H3,(H,26,30) |
| InChIKey | IYAJZHWFBKOPDE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|