C23H21F3N6O4 — CID 71282438
N-[2-methyl-5-[5-[[3-(2,2,2-trifluoroethoxy)propanoylamino]methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 71282438) has the molecular formula C23H21F3N6O4 and a molecular weight of 502.45 g/mol. Its IUPAC name is N-[2-methyl-5-[5-[[3-(2,2,2-trifluoroethoxy)propanoylamino]methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[2-methyl-5-[5-[[3-(2,2,2-trifluoroethoxy)propanoylamino]methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71282438 |
| Molecular Formula | C23H21F3N6O4 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[2-methyl-5-[5-[[3-(2,2,2-trifluoroethoxy)propanoylamino]methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2noc(CNC(=O)CCOCC(F)(F)F)n2)cc1NC(=O)c1cnc2ccccn12 |
| InChI | InChI=1S/C23H21F3N6O4/c1-14-5-6-15(10-16(14)29-22(34)17-11-27-18-4-2-3-8-32(17)18)21-30-20(36-31-21)12-28-19(33)7-9-35-13-23(24,25)26/h2-6,8,10-11H,7,9,12-13H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | JCFDYRIZIQTVFX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|