C25H26F3N5O3 — CID 144544768
N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylphenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxymethyl)imidazo[1,2-a]pyridine (PubChem CID 144544768) has the molecular formula C25H26F3N5O3 and a molecular weight of 501.51 g/mol. Its IUPAC name is N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylphenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxymethyl)imidazo[1,2-a]pyridine.
| Compound Name | N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylphenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxymethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 144544768 |
| Molecular Formula | C25H26F3N5O3 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylphenyl]formamide;3-methyl-6-(2,2,2-trifluoroethoxymethyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(-c2noc(C3CCC3)n2)cc1NC=O.Cc1cnc2ccc(COCC(F)(F)F)cn12 |
| InChI | InChI=1S/C14H15N3O2.C11H11F3N2O/c1-9-5-6-11(7-12(9)15-8-18)13-16-14(19-17-13)10-3-2-4-10;1-8-4-15-10-3-2-9(5-16(8)10)6-17-7-11(12,13)14/h5-8,10H,2-4H2,1H3,(H,15,18);2-5H,6-7H2,1H3 |
| InChIKey | DZULZKXMNKRZQO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|