C24H27FN6O2S — CID 144545275
N-[5-[5-(1-butylsulfanylazetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]formamide;3-methylimidazo[1,2-a]pyridine (PubChem CID 144545275) has the molecular formula C24H27FN6O2S and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[5-[5-(1-butylsulfanylazetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]formamide;3-methylimidazo[1,2-a]pyridine.
| Compound Name | N-[5-[5-(1-butylsulfanylazetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]formamide;3-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 144545275 |
| Molecular Formula | C24H27FN6O2S |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[5-[5-(1-butylsulfanylazetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]formamide;3-methylimidazo[1,2-a]pyridine |
| SMILES | CCCCSN1CC(c2nc(-c3ccc(F)c(NC=O)c3)no2)C1.Cc1cnc2ccccn12 |
| InChI | InChI=1S/C16H19FN4O2S.C8H8N2/c1-2-3-6-24-21-8-12(9-21)16-19-15(20-23-16)11-4-5-13(17)14(7-11)18-10-22;1-7-6-9-8-4-2-3-5-10(7)8/h4-5,7,10,12H,2-3,6,8-9H2,1H3,(H,18,22);2-6H,1H3 |
| InChIKey | PJURBZMYRVJUKW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|