C22H25N7O2 — CID 139515203
1-imidazo[1,2-a]pyridin-3-yloxy-2-[2-methyl-5-[5-(1-methylpiperidin-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]hydrazine (PubChem CID 139515203) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-3-yloxy-2-[2-methyl-5-[5-(1-methylpiperidin-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]hydrazine.
| Compound Name | 1-imidazo[1,2-a]pyridin-3-yloxy-2-[2-methyl-5-[5-(1-methylpiperidin-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]hydrazine |
|---|---|
| PubChem CID | 139515203 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-3-yloxy-2-[2-methyl-5-[5-(1-methylpiperidin-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]hydrazine |
| SMILES | Cc1ccc(-c2noc(C3CCCN(C)C3)n2)cc1NNOc1cnc2ccccn12 |
| InChI | InChI=1S/C22H25N7O2/c1-15-8-9-16(21-24-22(31-26-21)17-6-5-10-28(2)14-17)12-18(15)25-27-30-20-13-23-19-7-3-4-11-29(19)20/h3-4,7-9,11-13,17,25,27H,5-6,10,14H2,1-2H3 |
| InChIKey | WUXRETQGPULJMF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|