C21H22N6O2 — CID 144545278
N-[5-[5-(azetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]formamide;3-methylimidazo[1,2-a]pyridine (PubChem CID 144545278) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is N-[5-[5-(azetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]formamide;3-methylimidazo[1,2-a]pyridine.
| Compound Name | N-[5-[5-(azetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]formamide;3-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 144545278 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-[5-[5-(azetidin-3-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]formamide;3-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(-c2noc(C3CNC3)n2)cc1NC=O.Cc1cnc2ccccn12 |
| InChI | InChI=1S/C13H14N4O2.C8H8N2/c1-8-2-3-9(4-11(8)15-7-18)12-16-13(19-17-12)10-5-14-6-10;1-7-6-9-8-4-2-3-5-10(7)8/h2-4,7,10,14H,5-6H2,1H3,(H,15,18);2-6H,1H3 |
| InChIKey | YJRHBZHCKCWNGM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|