C25H25FN4O3 — CID 144548145
4-fluoro-3-formamido-N-(1-hydroxy-1-phenylpropan-2-yl)benzamide;3-methylimidazo[1,2-a]pyridine (PubChem CID 144548145) has the molecular formula C25H25FN4O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is 4-fluoro-3-formamido-N-(1-hydroxy-1-phenylpropan-2-yl)benzamide;3-methylimidazo[1,2-a]pyridine.
| Compound Name | 4-fluoro-3-formamido-N-(1-hydroxy-1-phenylpropan-2-yl)benzamide;3-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 144548145 |
| Molecular Formula | C25H25FN4O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-fluoro-3-formamido-N-(1-hydroxy-1-phenylpropan-2-yl)benzamide;3-methylimidazo[1,2-a]pyridine |
| SMILES | CC(NC(=O)c1ccc(F)c(NC=O)c1)C(O)c1ccccc1.Cc1cnc2ccccn12 |
| InChI | InChI=1S/C17H17FN2O3.C8H8N2/c1-11(16(22)12-5-3-2-4-6-12)20-17(23)13-7-8-14(18)15(9-13)19-10-21;1-7-6-9-8-4-2-3-5-10(7)8/h2-11,16,22H,1H3,(H,19,21)(H,20,23);2-6H,1H3 |
| InChIKey | FGVKTYLYKHHYCJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|