C11H10F3N3O3 — CID 136872390
2-amino-4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136872390) has the molecular formula C11H10F3N3O3 and a molecular weight of 289.21 g/mol. Its IUPAC name is 2-amino-4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136872390 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-amino-4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Nc1cc(-c2nc(COCC(F)(F)F)no2)ccc1O |
| InChI | InChI=1S/C11H10F3N3O3/c12-11(13,14)5-19-4-9-16-10(20-17-9)6-1-2-8(18)7(15)3-6/h1-3,18H,4-5,15H2 |
| InChIKey | OCPIVXWNWCBMFX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|