C11H9F4N3O2 — CID 103472687
4-fluoro-2-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 103472687) has the molecular formula C11H9F4N3O2 and a molecular weight of 291.20 g/mol. Its IUPAC name is 4-fluoro-2-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4-fluoro-2-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 103472687 |
| Molecular Formula | C11H9F4N3O2 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-fluoro-2-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccc(F)cc1-c1nc(COCC(F)(F)F)no1 |
| InChI | InChI=1S/C11H9F4N3O2/c12-6-1-2-8(16)7(3-6)10-17-9(18-20-10)4-19-5-11(13,14)15/h1-3H,4-5,16H2 |
| InChIKey | IOZBUHWLYCOMET-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|