C13H11FN4OS — CID 62797369
4-fluoro-2-[3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 62797369) has the molecular formula C13H11FN4OS and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-fluoro-2-[3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4-fluoro-2-[3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 62797369 |
| Molecular Formula | C13H11FN4OS |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-fluoro-2-[3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cc1csc(Cc2noc(-c3cc(F)ccc3N)n2)n1 |
| InChI | InChI=1S/C13H11FN4OS/c1-7-6-20-12(16-7)5-11-17-13(19-18-11)9-4-8(14)2-3-10(9)15/h2-4,6H,5,15H2,1H3 |
| InChIKey | UEHCMUZTSKPLOQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|