C12H11F3IN3O2 — CID 103146034
4-iodo-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 103146034) has the molecular formula C12H11F3IN3O2 and a molecular weight of 413.14 g/mol. Its IUPAC name is 4-iodo-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4-iodo-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 103146034 |
| Molecular Formula | C12H11F3IN3O2 |
| Molecular Weight | 413.14 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 4-iodo-2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccc(I)cc1-c1nc(CCOCC(F)(F)F)no1 |
| InChI | InChI=1S/C12H11F3IN3O2/c13-12(14,15)6-20-4-3-10-18-11(21-19-10)8-5-7(16)1-2-9(8)17/h1-2,5H,3-4,6,17H2 |
| InChIKey | DCWDKUIFXMQMSM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|