C13H16IN3O — CID 63889986
2-[3-(2,2-dimethylpropyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline (PubChem CID 63889986) has the molecular formula C13H16IN3O and a molecular weight of 357.20 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline.
| Compound Name | 2-[3-(2,2-dimethylpropyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline |
|---|---|
| PubChem CID | 63889986 |
| Molecular Formula | C13H16IN3O |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-[3-(2,2-dimethylpropyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline |
| SMILES | CC(C)(C)Cc1noc(-c2cc(I)ccc2N)n1 |
| InChI | InChI=1S/C13H16IN3O/c1-13(2,3)7-11-16-12(18-17-11)9-6-8(14)4-5-10(9)15/h4-6H,7,15H2,1-3H3 |
| InChIKey | CTUNGFJLDFYMGF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|