C7H6F3N5O3 — CID 103472541
4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 103472541) has the molecular formula C7H6F3N5O3 and a molecular weight of 265.15 g/mol. Its IUPAC name is 4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 103472541 |
| Molecular Formula | C7H6F3N5O3 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 4-[3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc(COCC(F)(F)F)no1 |
| InChI | InChI=1S/C7H6F3N5O3/c8-7(9,10)2-16-1-3-12-6(17-13-3)4-5(11)15-18-14-4/h1-2H2,(H2,11,15) |
| InChIKey | VQUPJLCWZXOSQM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |