C11H9N5O2 — CID 62808217
4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 62808217) has the molecular formula C11H9N5O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 62808217 |
| Molecular Formula | C11H9N5O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C11H9N5O2/c12-10-9(15-18-16-10)11-13-8(14-17-11)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,12,16) |
| InChIKey | ZGMFHGMKMINJDF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |